C15H26O3 — CID 146683365
(Z,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-ene-1,4-diol (PubChem CID 146683365) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (Z,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-ene-1,4-diol.
| Compound Name | (Z,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-ene-1,4-diol |
|---|---|
| PubChem CID | 146683365 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (Z,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-ene-1,4-diol |
| SMILES | C/C(=C/C(O)C[C@@H](C)[C@H]1C=C[C@](C)(O)CC1)CO |
| InChI | InChI=1S/C15H26O3/c1-11(10-16)8-14(17)9-12(2)13-4-6-15(3,18)7-5-13/h4,6,8,12-14,16-18H,5,7,9-10H2,1-3H3/b11-8-/t12-,13+,14?,15+/m1/s1 |
| InChIKey | MTNSZYGCSBZUGD-KDUVGBSDSA-N |
| XLogP | 2.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|