C15H26O3 — CID 146683367
2-[(4R)-4-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]pentylidene]propane-1,3-diol (PubChem CID 146683367) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-[(4R)-4-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]pentylidene]propane-1,3-diol.
| Compound Name | 2-[(4R)-4-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]pentylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 146683367 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 2-[(4R)-4-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]pentylidene]propane-1,3-diol |
| SMILES | C[C@H](CCC=C(CO)CO)[C@H]1C=C[C@](C)(O)CC1 |
| InChI | InChI=1S/C15H26O3/c1-12(4-3-5-13(10-16)11-17)14-6-8-15(2,18)9-7-14/h5-6,8,12,14,16-18H,3-4,7,9-11H2,1-2H3/t12-,14+,15+/m1/s1 |
| InChIKey | LPTHZECLXVTTRV-SNPRPXQTSA-N |
| XLogP | 2.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|