About (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one
(2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one (PubChem CID 146683370) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one.
Molecular Properties
| Compound Name | (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one |
| PubChem CID | 146683370 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one |
| SMILES | CCCC(=O)C[C@@H](C)[C@H]1C=C[C@](C)(O)CC1 |
| InChI | InChI=1S/C14H24O2/c1-4-5-13(15)10-11(2)12-6-8-14(3,16)9-7-12/h6,8,11-12,16H,4-5,7,9-10H2,1-3H3/t11-,12+,14+/m1/s1 |
| InChIKey | ORURTTPKMLIRJU-DYEKYZERSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one?
The IUPAC name of (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one (CID 146683370) is (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one.
What is the SMILES notation for (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one?
The canonical SMILES for (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one is CCCC(=O)C[C@@H](C)[C@H]1C=C[C@](C)(O)CC1.
What is the InChIKey of (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one?
The InChIKey is ORURTTPKMLIRJU-DYEKYZERSA-N. The full InChI is InChI=1S/C14H24O2/c1-4-5-13(15)10-11(2)12-6-8-14(3,16)9-7-12/h6,8,11-12,16H,4-5,7,9-10H2,1-3H3/t11-,12+,14+/m1/s1.
What are the key properties of (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one?
(2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one has a molecular weight of 224.34 g/mol, XLogP of 3.10, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]heptan-4-one is sourced from PubChem (CID 146683370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).