C14H22O2 — CID 146683371
(2R,4R,5R,8R)-4,8-dimethyl-2-[(E)-prop-1-enyl]-1-oxaspiro[4.5]dec-6-en-8-ol (PubChem CID 146683371) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2R,4R,5R,8R)-4,8-dimethyl-2-[(E)-prop-1-enyl]-1-oxaspiro[4.5]dec-6-en-8-ol.
| Compound Name | (2R,4R,5R,8R)-4,8-dimethyl-2-[(E)-prop-1-enyl]-1-oxaspiro[4.5]dec-6-en-8-ol |
|---|---|
| PubChem CID | 146683371 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2R,4R,5R,8R)-4,8-dimethyl-2-[(E)-prop-1-enyl]-1-oxaspiro[4.5]dec-6-en-8-ol |
| SMILES | C/C=C/[C@H]1C[C@@H](C)[C@]2(C=C[C@](C)(O)CC2)O1 |
| InChI | InChI=1S/C14H22O2/c1-4-5-12-10-11(2)14(16-12)8-6-13(3,15)7-9-14/h4-6,8,11-12,15H,7,9-10H2,1-3H3/b5-4+/t11-,12+,13+,14-/m1/s1 |
| InChIKey | WRZUFIHOTBWJST-WAIKKHEZSA-N |
| XLogP | 2.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|