C14H24O3 — CID 146683396
Trichobisabolin I (PubChem CID 146683396) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (2R,4S,4aR,6S,8aS)-2-[(2S)-2-hydroxypropyl]-4,7-dimethyl-3,4,4a,5,6,8a-hexahydro-2H-chromen-6-ol.
| Compound Name | Trichobisabolin I |
|---|---|
| PubChem CID | 146683396 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (2R,4S,4aR,6S,8aS)-2-[(2S)-2-hydroxypropyl]-4,7-dimethyl-3,4,4a,5,6,8a-hexahydro-2H-chromen-6-ol |
| SMILES | C[C@H]1C[C@@H](O[C@H]2[C@@H]1C[C@@H](C(=C2)C)O)C[C@H](C)O |
| InChI | InChI=1S/C14H24O3/c1-8-4-11(6-10(3)15)17-14-5-9(2)13(16)7-12(8)14/h5,8,10-16H,4,6-7H2,1-3H3/t8-,10-,11+,12+,13-,14+/m0/s1 |
| InChIKey | LFSDIJOJOMGZFF-ARHAKPMWSA-N |
| XLogP | 1.30 |
| TPSA | 49.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 300 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|