C12H16O3 — CID 146683521
(3Z,5E)-9-hydroxy-3,8-dimethylcyclodeca-3,5-diene-1,2-dione (PubChem CID 146683521) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3Z,5E)-9-hydroxy-3,8-dimethylcyclodeca-3,5-diene-1,2-dione.
| Compound Name | (3Z,5E)-9-hydroxy-3,8-dimethylcyclodeca-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 146683521 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3Z,5E)-9-hydroxy-3,8-dimethylcyclodeca-3,5-diene-1,2-dione |
| SMILES | C/C1=C/C=C/CC(C)C(O)CC(=O)C1=O |
| InChI | InChI=1S/C12H16O3/c1-8-5-3-4-6-9(2)12(15)11(14)7-10(8)13/h3-4,6,8,10,13H,5,7H2,1-2H3/b4-3+,9-6- |
| InChIKey | QQDLUMCAAJSIIJ-KXIWCOCFSA-N |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|