C15H22O3 — CID 146683534
(1R,3R,7S,8R,9S)-9-(2-hydroxypropan-2-yl)-1-methyl-2-methylidene-5-oxatricyclo[5.4.0.03,8]undecan-4-one (PubChem CID 146683534) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1R,3R,7S,8R,9S)-9-(2-hydroxypropan-2-yl)-1-methyl-2-methylidene-5-oxatricyclo[5.4.0.03,8]undecan-4-one.
| Compound Name | (1R,3R,7S,8R,9S)-9-(2-hydroxypropan-2-yl)-1-methyl-2-methylidene-5-oxatricyclo[5.4.0.03,8]undecan-4-one |
|---|---|
| PubChem CID | 146683534 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1R,3R,7S,8R,9S)-9-(2-hydroxypropan-2-yl)-1-methyl-2-methylidene-5-oxatricyclo[5.4.0.03,8]undecan-4-one |
| SMILES | C=C1[C@@H]2C(=O)OC[C@H]3[C@@H]2[C@@H](C(C)(C)O)CC[C@@]13C |
| InChI | InChI=1S/C15H22O3/c1-8-11-12-9(14(2,3)17)5-6-15(8,4)10(12)7-18-13(11)16/h9-12,17H,1,5-7H2,2-4H3/t9-,10-,11-,12-,15-/m0/s1 |
| InChIKey | PAHBCYFTCSJERU-VSBZFQJLSA-N |
| XLogP | 2.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|