C20H23NO3 — CID 146683573
(2R,3S,4S)-2-[(Z)-but-2-en-2-yl]-4-methoxy-3-methyl-8-phenyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one (PubChem CID 146683573) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2R,3S,4S)-2-[(Z)-but-2-en-2-yl]-4-methoxy-3-methyl-8-phenyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one.
| Compound Name | (2R,3S,4S)-2-[(Z)-but-2-en-2-yl]-4-methoxy-3-methyl-8-phenyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 146683573 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | (2R,3S,4S)-2-[(Z)-but-2-en-2-yl]-4-methoxy-3-methyl-8-phenyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
| SMILES | C/C=C(/C)[C@@H]1Oc2c(-c3ccccc3)c[nH]c(=O)c2[C@@H](OC)[C@@H]1C |
| InChI | InChI=1S/C20H23NO3/c1-5-12(2)17-13(3)18(23-4)16-19(24-17)15(11-21-20(16)22)14-9-7-6-8-10-14/h5-11,13,17-18H,1-4H3,(H,21,22)/b12-5-/t13-,17+,18+/m1/s1 |
| InChIKey | KZEICARMWDZDDS-DTAGQJGKSA-N |
| XLogP | 4.09 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|