C20H21NO3 — CID 146683574
(2S,6R)-2-methoxy-3,4,6-trimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),3,9-trien-12-one (PubChem CID 146683574) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (2S,6R)-2-methoxy-3,4,6-trimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),3,9-trien-12-one.
| Compound Name | (2S,6R)-2-methoxy-3,4,6-trimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),3,9-trien-12-one |
|---|---|
| PubChem CID | 146683574 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (2S,6R)-2-methoxy-3,4,6-trimethyl-9-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(8),3,9-trien-12-one |
| SMILES | CO[C@]12C(C)=C(C)C[C@@]1(C)Oc1c(-c3ccccc3)c[nH]c(=O)c12 |
| InChI | InChI=1S/C20H21NO3/c1-12-10-19(3)20(23-4,13(12)2)16-17(24-19)15(11-21-18(16)22)14-8-6-5-7-9-14/h5-9,11H,10H2,1-4H3,(H,21,22)/t19-,20+/m1/s1 |
| InChIKey | CAKASVAVWPVPNQ-UXHICEINSA-N |
| XLogP | 3.77 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|