About (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one
(2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one (PubChem CID 146683654) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one |
| PubChem CID | 146683654 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)O[C@@H]([C@H](C)C[C@H](C)CC(C)=O)C1 |
| InChI | InChI=1S/C14H22O4/c1-9(6-11(3)15)5-10(2)13-7-12(17-4)8-14(16)18-13/h8-10,13H,5-7H2,1-4H3/t9-,10+,13+/m0/s1 |
| InChIKey | QUILGFVARLSNLK-OPQQBVKSSA-N |
| XLogP | 2.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one?
The IUPAC name of (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one (CID 146683654) is (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one.
What is the SMILES notation for (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one?
The canonical SMILES for (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one is COC1=CC(=O)O[C@@H]([C@H](C)C[C@H](C)CC(C)=O)C1.
What is the InChIKey of (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one?
The InChIKey is QUILGFVARLSNLK-OPQQBVKSSA-N. The full InChI is InChI=1S/C14H22O4/c1-9(6-11(3)15)5-10(2)13-7-12(17-4)8-14(16)18-13/h8-10,13H,5-7H2,1-4H3/t9-,10+,13+/m0/s1.
What are the key properties of (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one?
(2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one has a molecular weight of 254.33 g/mol, XLogP of 2.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-methoxy-2-[(2R,4S)-4-methyl-6-oxoheptan-2-yl]-2,3-dihydropyran-6-one is sourced from PubChem (CID 146683654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).