C17H17NO3 — CID 146683962
(5S)-5,9-dihydroxy-1,3,5,8-tetramethylbenzo[g]isoquinolin-10-one (PubChem CID 146683962) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (5S)-5,9-dihydroxy-1,3,5,8-tetramethylbenzo[g]isoquinolin-10-one.
| Compound Name | (5S)-5,9-dihydroxy-1,3,5,8-tetramethylbenzo[g]isoquinolin-10-one |
|---|---|
| PubChem CID | 146683962 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (5S)-5,9-dihydroxy-1,3,5,8-tetramethylbenzo[g]isoquinolin-10-one |
| SMILES | Cc1cc2c(c(C)n1)C(=O)c1c(ccc(C)c1O)[C@@]2(C)O |
| InChI | InChI=1S/C17H17NO3/c1-8-5-6-11-14(15(8)19)16(20)13-10(3)18-9(2)7-12(13)17(11,4)21/h5-7,19,21H,1-4H3/t17-/m1/s1 |
| InChIKey | GTLFRJKAROJZPU-QGZVFWFLSA-N |
| XLogP | 2.51 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |