C11H18O5 — CID 146684114
(1R,2R,3S,4S)-5-(3-hydroxy-3-methylbut-1-enyl)cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 146684114) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1R,2R,3S,4S)-5-(3-hydroxy-3-methylbut-1-enyl)cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S)-5-(3-hydroxy-3-methylbut-1-enyl)cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 146684114 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1R,2R,3S,4S)-5-(3-hydroxy-3-methylbut-1-enyl)cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | CC(C)(O)C=CC1=C[C@@H](O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H18O5/c1-11(2,16)4-3-6-5-7(12)9(14)10(15)8(6)13/h3-5,7-10,12-16H,1-2H3/t7-,8+,9-,10+/m1/s1 |
| InChIKey | PMWWGXUFWVBHBI-RGOKHQFPSA-N |
| XLogP | -1.30 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |