About (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid
(4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid (PubChem CID 146684162) has the molecular formula C15H24O3
and a molecular weight of 252.35 g/mol. Its IUPAC name is (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid.
Molecular Properties
| Compound Name | (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid |
| PubChem CID | 146684162 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid |
| SMILES | C=C1CCCC(C)(C)[C@H]1C[C@H](O)C(C)=CC(=O)O |
| InChI | InChI=1S/C15H24O3/c1-10-6-5-7-15(3,4)12(10)9-13(16)11(2)8-14(17)18/h8,12-13,16H,1,5-7,9H2,2-4H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | PCFIOAAUTRUKGX-STQMWFEESA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid?
The IUPAC name of (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid (CID 146684162) is (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid.
What is the SMILES notation for (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid?
The canonical SMILES for (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid is C=C1CCCC(C)(C)[C@H]1C[C@H](O)C(C)=CC(=O)O.
What is the InChIKey of (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid?
The InChIKey is PCFIOAAUTRUKGX-STQMWFEESA-N. The full InChI is InChI=1S/C15H24O3/c1-10-6-5-7-15(3,4)12(10)9-13(16)11(2)8-14(17)18/h8,12-13,16H,1,5-7,9H2,2-4H3,(H,17,18)/t12-,13-/m0/s1.
What are the key properties of (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid?
(4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid has a molecular weight of 252.35 g/mol, XLogP of 3.15, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-4-hydroxy-3-methylpent-2-enoic acid is sourced from PubChem (CID 146684162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).