About (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid
(3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid (PubChem CID 146684164) has the molecular formula C15H26O2
and a molecular weight of 238.37 g/mol. Its IUPAC name is (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid.
Molecular Properties
| Compound Name | (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid |
| PubChem CID | 146684164 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid |
| SMILES | C=C1CCCC(C)(C)[C@H]1CC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C15H26O2/c1-11(10-14(16)17)7-8-13-12(2)6-5-9-15(13,3)4/h11,13H,2,5-10H2,1,3-4H3,(H,16,17)/t11-,13+/m1/s1 |
| InChIKey | HOHBPQJOCNDYKZ-YPMHNXCESA-N |
| XLogP | 4.26 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid?
The IUPAC name of (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid (CID 146684164) is (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid.
What is the SMILES notation for (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid?
The canonical SMILES for (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid is C=C1CCCC(C)(C)[C@H]1CC[C@@H](C)CC(=O)O.
What is the InChIKey of (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid?
The InChIKey is HOHBPQJOCNDYKZ-YPMHNXCESA-N. The full InChI is InChI=1S/C15H26O2/c1-11(10-14(16)17)7-8-13-12(2)6-5-9-15(13,3)4/h11,13H,2,5-10H2,1,3-4H3,(H,16,17)/t11-,13+/m1/s1.
What are the key properties of (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid?
(3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid has a molecular weight of 238.37 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-5-[(1R)-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpentanoic acid is sourced from PubChem (CID 146684164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).