C31H44O5 — CID 146684204
methyl (6R)-6-[(5R,10S,13R,14R,16S,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-6,7,12,15,16,17-hexahydro-5H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate (PubChem CID 146684204) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl (6R)-6-[(5R,10S,13R,14R,16S,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-6,7,12,15,16,17-hexahydro-5H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate.
| Compound Name | methyl (6R)-6-[(5R,10S,13R,14R,16S,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-6,7,12,15,16,17-hexahydro-5H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
|---|---|
| PubChem CID | 146684204 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | methyl (6R)-6-[(5R,10S,13R,14R,16S,17R)-16-hydroxy-4,4,10,13,14-pentamethyl-3,11-dioxo-6,7,12,15,16,17-hexahydro-5H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoate |
| SMILES | COC(=O)C(C)=CCC[C@@H](C)[C@H]1[C@@H](O)C[C@@]2(C)C3=C(C(=O)C[C@]12C)[C@@]1(C)C=CC(=O)C(C)(C)[C@@H]1CC3 |
| InChI | InChI=1S/C31H44O5/c1-18(10-9-11-19(2)27(35)36-8)25-21(32)16-30(6)20-12-13-23-28(3,4)24(34)14-15-29(23,5)26(20)22(33)17-31(25,30)7/h11,14-15,18,21,23,25,32H,9-10,12-13,16-17H2,1-8H3/t18-,21+,23+,25+,29+,30+,31-/m1/s1 |
| InChIKey | YQAPMBXWOXXAAD-CITBWNQLSA-N |
| XLogP | 5.77 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|