About 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione
6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione (PubChem CID 146684220) has the molecular formula C12H10O5
and a molecular weight of 234.21 g/mol. Its IUPAC name is 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione |
| PubChem CID | 146684220 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione |
| SMILES | COC1=CC(=O)c2c(cc(O)c(O)c2C)C1=O |
| InChI | InChI=1S/C12H10O5/c1-5-10-6(3-8(14)11(5)15)12(16)9(17-2)4-7(10)13/h3-4,14-15H,1-2H3 |
| InChIKey | KUPAUQHGUZLVLB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione?
The IUPAC name of 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione (CID 146684220) is 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione.
What is the SMILES notation for 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione?
The canonical SMILES for 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione is COC1=CC(=O)c2c(cc(O)c(O)c2C)C1=O.
What is the InChIKey of 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione?
The InChIKey is KUPAUQHGUZLVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O5/c1-5-10-6(3-8(14)11(5)15)12(16)9(17-2)4-7(10)13/h3-4,14-15H,1-2H3.
What are the key properties of 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione?
6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione has a molecular weight of 234.21 g/mol, XLogP of 1.32, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydroxy-2-methoxy-5-methylnaphthalene-1,4-dione is sourced from PubChem (CID 146684220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).