C18H32O6 — CID 146684222
(1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(Z,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol (PubChem CID 146684222) has the molecular formula C18H32O6 and a molecular weight of 344.45 g/mol. Its IUPAC name is (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(Z,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(Z,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 146684222 |
| Molecular Formula | C18H32O6 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (1R,2S,3S,4R)-5-(hydroxymethyl)-6-[(Z,3S)-3-hydroxyundec-1-enyl]cyclohex-5-ene-1,2,3,4-tetrol |
| SMILES | CCCCCCCC[C@H](O)/C=C\C1=C(CO)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32O6/c1-2-3-4-5-6-7-8-12(20)9-10-13-14(11-19)16(22)18(24)17(23)15(13)21/h9-10,12,15-24H,2-8,11H2,1H3/b10-9-/t12-,15+,16+,17-,18-/m0/s1 |
| InChIKey | DAABLEBQAMFRQW-QSBUVSRSSA-N |
| XLogP | 0.40 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|