About 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one
4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one (PubChem CID 146684237) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one |
| PubChem CID | 146684237 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one |
| SMILES | Cc1c(O)cc([C@@H](C)[C@H](C)O)oc1=O |
| InChI | InChI=1S/C10H14O4/c1-5(7(3)11)9-4-8(12)6(2)10(13)14-9/h4-5,7,11-12H,1-3H3/t5-,7-/m0/s1 |
| InChIKey | HCULHNPJKWMRJT-FSPLSTOPSA-N |
| XLogP | 1.14 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one?
The IUPAC name of 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one (CID 146684237) is 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one.
What is the SMILES notation for 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one?
The canonical SMILES for 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one is Cc1c(O)cc([C@@H](C)[C@H](C)O)oc1=O.
What is the InChIKey of 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one?
The InChIKey is HCULHNPJKWMRJT-FSPLSTOPSA-N. The full InChI is InChI=1S/C10H14O4/c1-5(7(3)11)9-4-8(12)6(2)10(13)14-9/h4-5,7,11-12H,1-3H3/t5-,7-/m0/s1.
What are the key properties of 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one?
4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one has a molecular weight of 198.22 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-[(2S,3S)-3-hydroxybutan-2-yl]-3-methylpyran-2-one is sourced from PubChem (CID 146684237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).