C21H26O5 — CID 146684292
2-(2,5-dihydroxyphenyl)-4-[2-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2H-furan-5-one (PubChem CID 146684292) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is 2-(2,5-dihydroxyphenyl)-4-[2-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2H-furan-5-one.
| Compound Name | 2-(2,5-dihydroxyphenyl)-4-[2-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 146684292 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2-(2,5-dihydroxyphenyl)-4-[2-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]ethyl]-2H-furan-5-one |
| SMILES | C=C1CC[C@H](O)C(C)(C)[C@@H]1CCC1=CC(c2cc(O)ccc2O)OC1=O |
| InChI | InChI=1S/C21H26O5/c1-12-4-9-19(24)21(2,3)16(12)7-5-13-10-18(26-20(13)25)15-11-14(22)6-8-17(15)23/h6,8,10-11,16,18-19,22-24H,1,4-5,7,9H2,2-3H3/t16-,18?,19+/m1/s1 |
| InChIKey | FCBRYGVFLPXTSC-WDOSNPKHSA-N |
| XLogP | 3.76 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|