C40H36N6O4 — CID 146684305
(3R,6S)-3-benzyl-6-[[7-[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-2-yl]-1H-indol-3-yl]methyl]piperazine-2,5-dione (PubChem CID 146684305) has the molecular formula C40H36N6O4 and a molecular weight of 664.77 g/mol. Its IUPAC name is (3R,6S)-3-benzyl-6-[[7-[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-2-yl]-1H-indol-3-yl]methyl]piperazine-2,5-dione.
| Compound Name | (3R,6S)-3-benzyl-6-[[7-[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-2-yl]-1H-indol-3-yl]methyl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 146684305 |
| Molecular Formula | C40H36N6O4 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | (3R,6S)-3-benzyl-6-[[7-[3-[[(2S,5R)-5-benzyl-3,6-dioxopiperazin-2-yl]methyl]-1H-indol-2-yl]-1H-indol-3-yl]methyl]piperazine-2,5-dione |
| SMILES | O=C1N[C@H](Cc2ccccc2)C(=O)N[C@H]1Cc1c(-c2cccc3c(C[C@@H]4NC(=O)[C@@H](Cc5ccccc5)NC4=O)c[nH]c23)[nH]c2ccccc12 |
| InChI | InChI=1S/C40H36N6O4/c47-37-31(18-23-10-3-1-4-11-23)43-39(49)33(45-37)20-25-22-41-35-26(25)15-9-16-28(35)36-29(27-14-7-8-17-30(27)42-36)21-34-40(50)44-32(38(48)46-34)19-24-12-5-2-6-13-24/h1-17,22,31-34,41-42H,18-21H2,(H,43,49)(H,44,50)(H,45,47)(H,46,48)/t31-,32-,33+,34+/m1/s1 |
| InChIKey | FOUCSSDISKIFNZ-WZJLIZBTSA-N |
| XLogP | 3.85 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |