C15H22O3 — CID 146684320
(1S,6S,6aS,9aR)-1-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one (PubChem CID 146684320) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (1S,6S,6aS,9aR)-1-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one.
| Compound Name | (1S,6S,6aS,9aR)-1-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one |
|---|---|
| PubChem CID | 146684320 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (1S,6S,6aS,9aR)-1-hydroxy-6,8,8-trimethyl-1,4,5,6,6a,7,9,9a-octahydroazuleno[4,5-c]furan-3-one |
| SMILES | C[C@H]1CCC2=C([C@@H](O)OC2=O)[C@@H]2CC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C15H22O3/c1-8-4-5-9-12(14(17)18-13(9)16)11-7-15(2,3)6-10(8)11/h8,10-11,14,17H,4-7H2,1-3H3/t8-,10-,11+,14-/m0/s1 |
| InChIKey | GUNCMJRPHLTLMA-CBRVECNMSA-N |
| XLogP | 2.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |