C15H22O4 — CID 146684329
(5R,6S)-5,6-dihydroxy-2,6-dimethyl-3-[(E)-2-oxohept-5-enyl]cyclohex-2-en-1-one (PubChem CID 146684329) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (5R,6S)-5,6-dihydroxy-2,6-dimethyl-3-[(E)-2-oxohept-5-enyl]cyclohex-2-en-1-one.
| Compound Name | (5R,6S)-5,6-dihydroxy-2,6-dimethyl-3-[(E)-2-oxohept-5-enyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 146684329 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (5R,6S)-5,6-dihydroxy-2,6-dimethyl-3-[(E)-2-oxohept-5-enyl]cyclohex-2-en-1-one |
| SMILES | C/C=C/CCC(=O)CC1=C(C)C(=O)[C@@](C)(O)[C@H](O)C1 |
| InChI | InChI=1S/C15H22O4/c1-4-5-6-7-12(16)8-11-9-13(17)15(3,19)14(18)10(11)2/h4-5,13,17,19H,6-9H2,1-3H3/b5-4+/t13-,15+/m1/s1 |
| InChIKey | CWFBVTSRJIREEZ-GRJAPKLVSA-N |
| XLogP | 1.70 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|