C15H26O5 — CID 146684382
1-[(2R,3R,3aR,6S,7R,7aS)-2,6,7-trihydroxy-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-1-benzofuran-2-yl]-3-methylbutan-1-one (PubChem CID 146684382) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is 1-[(2R,3R,3aR,6S,7R,7aS)-2,6,7-trihydroxy-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-1-benzofuran-2-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(2R,3R,3aR,6S,7R,7aS)-2,6,7-trihydroxy-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-1-benzofuran-2-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 146684382 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | 1-[(2R,3R,3aR,6S,7R,7aS)-2,6,7-trihydroxy-3,6-dimethyl-3,3a,4,5,7,7a-hexahydro-1-benzofuran-2-yl]-3-methylbutan-1-one |
| SMILES | CC(C)CC(=O)[C@]1(O)O[C@H]2[C@H](CC[C@](C)(O)[C@@H]2O)[C@H]1C |
| InChI | InChI=1S/C15H26O5/c1-8(2)7-11(16)15(19)9(3)10-5-6-14(4,18)13(17)12(10)20-15/h8-10,12-13,17-19H,5-7H2,1-4H3/t9-,10-,12+,13-,14+,15-/m1/s1 |
| InChIKey | KKKOATVJCSRUJL-MDUHGFIHSA-N |
| XLogP | 0.85 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |