C20H30O3 — CID 146684489
(3R,5S,8E,10S,12S,13R,16S)-10-hydroxy-5,9,12,13,16-pentamethyl-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-2-one (PubChem CID 146684489) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3R,5S,8E,10S,12S,13R,16S)-10-hydroxy-5,9,12,13,16-pentamethyl-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-2-one.
| Compound Name | (3R,5S,8E,10S,12S,13R,16S)-10-hydroxy-5,9,12,13,16-pentamethyl-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-2-one |
|---|---|
| PubChem CID | 146684489 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3R,5S,8E,10S,12S,13R,16S)-10-hydroxy-5,9,12,13,16-pentamethyl-4-oxatricyclo[10.3.1.03,5]hexadeca-1(15),8-dien-2-one |
| SMILES | C/C1=C\CC[C@]2(C)O[C@H]2C(=O)C2=CC[C@@H](C)[C@](C)(C[C@@H]1O)[C@@H]2C |
| InChI | InChI=1S/C20H30O3/c1-12-7-6-10-20(5)18(23-20)17(22)15-9-8-13(2)19(4,14(15)3)11-16(12)21/h7,9,13-14,16,18,21H,6,8,10-11H2,1-5H3/b12-7+/t13-,14-,16+,18+,19+,20+/m1/s1 |
| InChIKey | PCWBJBXZOODNTG-FMDUDUGBSA-N |
| XLogP | 3.81 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|