C17H25NO4 — CID 146684497
3-[[(2E,4E,6E,8E)-13-hydroxytetradeca-2,4,6,8-tetraenoyl]amino]propanoic acid (PubChem CID 146684497) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is 3-[[(2E,4E,6E,8E)-13-hydroxytetradeca-2,4,6,8-tetraenoyl]amino]propanoic acid.
| Compound Name | 3-[[(2E,4E,6E,8E)-13-hydroxytetradeca-2,4,6,8-tetraenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146684497 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-[[(2E,4E,6E,8E)-13-hydroxytetradeca-2,4,6,8-tetraenoyl]amino]propanoic acid |
| SMILES | CC(O)CCC/C=C/C=C/C=C/C=C/C(=O)NCCC(=O)O |
| InChI | InChI=1S/C17H25NO4/c1-15(19)11-9-7-5-3-2-4-6-8-10-12-16(20)18-14-13-17(21)22/h2-6,8,10,12,15,19H,7,9,11,13-14H2,1H3,(H,18,20)(H,21,22)/b4-2+,5-3+,8-6+,12-10+ |
| InChIKey | SKQMHIZHCBUGRI-RBFBEFBLSA-N |
| XLogP | 2.35 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|