C29H26Cl2O8 — CID 146684582
(5aR,11aR)-10-chloro-7-(3-chloro-6-hydroxy-4-methoxy-2-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione (PubChem CID 146684582) has the molecular formula C29H26Cl2O8 and a molecular weight of 573.43 g/mol. Its IUPAC name is (5aR,11aR)-10-chloro-7-(3-chloro-6-hydroxy-4-methoxy-2-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione.
| Compound Name | (5aR,11aR)-10-chloro-7-(3-chloro-6-hydroxy-4-methoxy-2-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione |
|---|---|
| PubChem CID | 146684582 |
| Molecular Formula | C29H26Cl2O8 |
| Molecular Weight | 573.43 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | (5aR,11aR)-10-chloro-7-(3-chloro-6-hydroxy-4-methoxy-2-methylphenyl)-2,4,5a-trihydroxy-9-methoxy-12,12-dimethyl-11,11a-dihydrotetracene-5,6-dione |
| SMILES | COc1cc(O)c(-c2cc(OC)c(Cl)c3c2C(=O)[C@@]2(O)C(=O)c4c(O)cc(O)cc4C(C)(C)[C@H]2C3)c(C)c1Cl |
| InChI | InChI=1S/C29H26Cl2O8/c1-11-21(17(34)10-19(39-5)24(11)30)13-8-18(38-4)25(31)14-9-20-28(2,3)15-6-12(32)7-16(33)23(15)27(36)29(20,37)26(35)22(13)14/h6-8,10,20,32-34,37H,9H2,1-5H3/t20-,29-/m1/s1 |
| InChIKey | DZLMIXIOUIFBDM-ACSYHNTCSA-N |
| XLogP | 5.36 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|