C9H13N5O2 — CID 146684612
2-amino-5-propanoyl-3,6,7,8-tetrahydropteridin-4-one (PubChem CID 146684612) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-amino-5-propanoyl-3,6,7,8-tetrahydropteridin-4-one.
| Compound Name | 2-amino-5-propanoyl-3,6,7,8-tetrahydropteridin-4-one |
|---|---|
| PubChem CID | 146684612 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-amino-5-propanoyl-3,6,7,8-tetrahydropteridin-4-one |
| SMILES | CCC(=O)N1CCNc2nc(N)[nH]c(=O)c21 |
| InChI | InChI=1S/C9H13N5O2/c1-2-5(15)14-4-3-11-7-6(14)8(16)13-9(10)12-7/h2-4H2,1H3,(H4,10,11,12,13,16) |
| InChIKey | CYFWJZPZWIBVRD-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |