C13H18O2 — CID 146684972
(2E,4E,6R,7R,8E,10E)-trideca-2,4,8,10,12-pentaene-6,7-diol (PubChem CID 146684972) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2E,4E,6R,7R,8E,10E)-trideca-2,4,8,10,12-pentaene-6,7-diol.
| Compound Name | (2E,4E,6R,7R,8E,10E)-trideca-2,4,8,10,12-pentaene-6,7-diol |
|---|---|
| PubChem CID | 146684972 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2E,4E,6R,7R,8E,10E)-trideca-2,4,8,10,12-pentaene-6,7-diol |
| SMILES | C=C/C=C/C=C/[C@@H](O)[C@H](O)/C=C/C=C/C |
| InChI | InChI=1S/C13H18O2/c1-3-5-7-9-11-13(15)12(14)10-8-6-4-2/h3-15H,1H2,2H3/b6-4+,7-5+,10-8+,11-9+/t12-,13-/m1/s1 |
| InChIKey | ZZRIFTCWAGMQHH-QCKRLIEVSA-N |
| XLogP | 2.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|