About N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine
N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine (PubChem CID 146686650) has the molecular formula C8H17N3
and a molecular weight of 155.25 g/mol. Its IUPAC name is N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine.
Molecular Properties
| Compound Name | N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine |
| PubChem CID | 146686650 |
| Molecular Formula | C8H17N3 |
| Molecular Weight | 155.25 g/mol |
| Exact Mass | 155.14 |
| IUPAC Name | N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine |
| SMILES | CNN1CC2CCC1CN2C |
| InChI | InChI=1S/C8H17N3/c1-9-11-6-7-3-4-8(11)5-10(7)2/h7-9H,3-6H2,1-2H3 |
| InChIKey | PSSMPSVBVOQSHK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine?
The IUPAC name of N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine (CID 146686650) is N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine.
What is the SMILES notation for N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine?
The canonical SMILES for N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine is CNN1CC2CCC1CN2C.
What is the InChIKey of N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine?
The InChIKey is PSSMPSVBVOQSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3/c1-9-11-6-7-3-4-8(11)5-10(7)2/h7-9H,3-6H2,1-2H3.
What are the key properties of N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine?
N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine has a molecular weight of 155.25 g/mol, XLogP of -0.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-2,5-diazabicyclo[2.2.2]octan-2-amine is sourced from PubChem (CID 146686650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).