C35H64O4Si2 — CID 146687842
propan-2-yl (2E,4E,6E,8E,10E,12R,13S,15S)-12,15-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10,13-tetramethylhexadeca-2,4,6,8,10-pentaenoate (PubChem CID 146687842) has the molecular formula C35H64O4Si2 and a molecular weight of 605.07 g/mol. Its IUPAC name is propan-2-yl (2E,4E,6E,8E,10E,12R,13S,15S)-12,15-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10,13-tetramethylhexadeca-2,4,6,8,10-pentaenoate.
| Compound Name | propan-2-yl (2E,4E,6E,8E,10E,12R,13S,15S)-12,15-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10,13-tetramethylhexadeca-2,4,6,8,10-pentaenoate |
|---|---|
| PubChem CID | 146687842 |
| Molecular Formula | C35H64O4Si2 |
| Molecular Weight | 605.07 g/mol |
| Exact Mass | 604.43 |
| IUPAC Name | propan-2-yl (2E,4E,6E,8E,10E,12R,13S,15S)-12,15-bis[[tert-butyl(dimethyl)silyl]oxy]-4,6,10,13-tetramethylhexadeca-2,4,6,8,10-pentaenoate |
| SMILES | CC(=C\C=C\C(C)=C\[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C)/C=C(C)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C35H64O4Si2/c1-26(2)37-33(36)22-21-29(5)23-27(3)19-18-20-28(4)24-32(39-41(16,17)35(11,12)13)30(6)25-31(7)38-40(14,15)34(8,9)10/h18-24,26,30-32H,25H2,1-17H3/b20-18+,22-21+,27-19+,28-24+,29-23+/t30-,31-,32-/m0/s1 |
| InChIKey | PWWWNJOTTLFDSG-DFAWEJERSA-N |
| XLogP | 10.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.07 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|