C30H36S — CID 14668874
1,3-bis(4-tert-butylphenyl)-5,6-dimethyl-4,7-dihydro-2-benzothiophene (PubChem CID 14668874) has the molecular formula C30H36S and a molecular weight of 428.69 g/mol. Its IUPAC name is 1,3-bis(4-tert-butylphenyl)-5,6-dimethyl-4,7-dihydro-2-benzothiophene.
| Compound Name | 1,3-bis(4-tert-butylphenyl)-5,6-dimethyl-4,7-dihydro-2-benzothiophene |
|---|---|
| PubChem CID | 14668874 |
| Molecular Formula | C30H36S |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 1,3-bis(4-tert-butylphenyl)-5,6-dimethyl-4,7-dihydro-2-benzothiophene |
| SMILES | CC1=C(C)Cc2c(-c3ccc(C(C)(C)C)cc3)sc(-c3ccc(C(C)(C)C)cc3)c2C1 |
| InChI | InChI=1S/C30H36S/c1-19-17-25-26(18-20(19)2)28(22-11-15-24(16-12-22)30(6,7)8)31-27(25)21-9-13-23(14-10-21)29(3,4)5/h9-16H,17-18H2,1-8H3 |
| InChIKey | LWJLPDPXOHBKHY-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|