C16H10N2O3 — CID 14669033
methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate (PubChem CID 14669033) has the molecular formula C16H10N2O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate.
| Compound Name | methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate |
|---|---|
| PubChem CID | 14669033 |
| Molecular Formula | C16H10N2O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | methyl 2-oxo-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaene-7-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n3c(=O)ccc(n1)c23 |
| InChI | InChI=1S/C16H10N2O3/c1-21-16(20)12-8-10-9-4-2-3-5-13(9)18-14(19)7-6-11(17-12)15(10)18/h2-8H,1H3 |
| InChIKey | XQXQAMBHZZKHOL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |