C18H19N3O3 — CID 14669051
methyl 3-(3-hydroxypropyl)-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate (PubChem CID 14669051) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is methyl 3-(3-hydroxypropyl)-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate.
| Compound Name | methyl 3-(3-hydroxypropyl)-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
|---|---|
| PubChem CID | 14669051 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | methyl 3-(3-hydroxypropyl)-1,3,6-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5(16),6,8,10,12,14-hexaene-7-carboxylate |
| SMILES | COC(=O)c1cc2c3ccccc3n3c2c(n1)CN(CCCO)C3 |
| InChI | InChI=1S/C18H19N3O3/c1-24-18(23)14-9-13-12-5-2-3-6-16(12)21-11-20(7-4-8-22)10-15(19-14)17(13)21/h2-3,5-6,9,22H,4,7-8,10-11H2,1H3 |
| InChIKey | FFYGSIGEKVLYDH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |