C28H27FNO+ — CID 146692905
6-(2,2-dimethylpropyl)-1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium (PubChem CID 146692905) has the molecular formula C28H27FNO+ and a molecular weight of 412.53 g/mol. Its IUPAC name is 6-(2,2-dimethylpropyl)-1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium.
| Compound Name | 6-(2,2-dimethylpropyl)-1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium |
|---|---|
| PubChem CID | 146692905 |
| Molecular Formula | C28H27FNO+ |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | 6-(2,2-dimethylpropyl)-1-(7-fluoro-3-methyldibenzofuran-4-yl)-2-methylisoquinolin-2-ium |
| SMILES | Cc1ccc2c(oc3cc(F)ccc32)c1-c1c2ccc(CC(C)(C)C)cc2cc[n+]1C |
| InChI | InChI=1S/C28H27FNO/c1-17-6-9-23-22-11-8-20(29)15-24(22)31-27(23)25(17)26-21-10-7-18(16-28(2,3)4)14-19(21)12-13-30(26)5/h6-15H,16H2,1-5H3/q+1 |
| InChIKey | KQRBZWNDNHPQFW-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|