C25H26Cl3NO3S — CID 146700658
1-[3-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl]-2-(oxan-4-yl)ethanone (PubChem CID 146700658) has the molecular formula C25H26Cl3NO3S and a molecular weight of 526.91 g/mol. Its IUPAC name is 1-[3-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 1-[3-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 146700658 |
| Molecular Formula | C25H26Cl3NO3S |
| Molecular Weight | 526.91 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-[3-[5-methyl-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-3-yl]-4,5,6,7-tetrahydro-2-benzothiophen-1-yl]-2-(oxan-4-yl)ethanone |
| SMILES | CC1(c2cc(Cl)c(Cl)c(Cl)c2)CC(c2sc(C(=O)CC3CCOCC3)c3c2CCCC3)=NO1 |
| InChI | InChI=1S/C25H26Cl3NO3S/c1-25(15-11-18(26)22(28)19(27)12-15)13-20(29-32-25)23-16-4-2-3-5-17(16)24(33-23)21(30)10-14-6-8-31-9-7-14/h11-12,14H,2-10,13H2,1H3 |
| InChIKey | QTKAKEIAGMYMEC-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.91 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|