About 3-azidocyclohexane-1,2-dione
3-azidocyclohexane-1,2-dione (PubChem CID 14670211) has the molecular formula C6H7N3O2
and a molecular weight of 153.14 g/mol. Its IUPAC name is 3-azidocyclohexane-1,2-dione.
Molecular Properties
| Compound Name | 3-azidocyclohexane-1,2-dione |
| PubChem CID | 14670211 |
| Molecular Formula | C6H7N3O2 |
| Molecular Weight | 153.14 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | 3-azidocyclohexane-1,2-dione |
| SMILES | [N-]=[N+]=NC1CCCC(=O)C1=O |
| InChI | InChI=1S/C6H7N3O2/c7-9-8-4-2-1-3-5(10)6(4)11/h4H,1-3H2 |
| InChIKey | UIELKXJPKMHUCD-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 82.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.14 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-azidocyclohexane-1,2-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidocyclohexane-1,2-dione?
The IUPAC name of 3-azidocyclohexane-1,2-dione (CID 14670211) is 3-azidocyclohexane-1,2-dione.
What is the SMILES notation for 3-azidocyclohexane-1,2-dione?
The canonical SMILES for 3-azidocyclohexane-1,2-dione is [N-]=[N+]=NC1CCCC(=O)C1=O.
What is the InChIKey of 3-azidocyclohexane-1,2-dione?
The InChIKey is UIELKXJPKMHUCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O2/c7-9-8-4-2-1-3-5(10)6(4)11/h4H,1-3H2.
What are the key properties of 3-azidocyclohexane-1,2-dione?
3-azidocyclohexane-1,2-dione has a molecular weight of 153.14 g/mol, XLogP of 0.99, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidocyclohexane-1,2-dione is sourced from PubChem (CID 14670211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).