C14H27F3N2O — CID 146703842
1-(2,2,6,6-tetramethylheptan-3-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 146703842) has the molecular formula C14H27F3N2O and a molecular weight of 296.38 g/mol. Its IUPAC name is 1-(2,2,6,6-tetramethylheptan-3-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2,2,6,6-tetramethylheptan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 146703842 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 1-(2,2,6,6-tetramethylheptan-3-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)(C)CCC(NC(=O)NCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H27F3N2O/c1-12(2,3)8-7-10(13(4,5)6)19-11(20)18-9-14(15,16)17/h10H,7-9H2,1-6H3,(H2,18,19,20) |
| InChIKey | QWZPVYDOLNZDBZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |