About 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine
4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine (PubChem CID 146704594) has the molecular formula C27H24ClN
and a molecular weight of 397.95 g/mol. Its IUPAC name is 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine.
Molecular Properties
| Compound Name | 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine |
| PubChem CID | 146704594 |
| Molecular Formula | C27H24ClN |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(-c2ccnc(Cl)c2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C27H24ClN/c1-27(2,3)22-17-23(19-10-6-4-7-11-19)26(21-14-15-29-25(28)16-21)24(18-22)20-12-8-5-9-13-20/h4-18H,1-3H3 |
| InChIKey | QXDLAHBMHZMGLO-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine?
The IUPAC name of 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine (CID 146704594) is 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine.
What is the SMILES notation for 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine?
The canonical SMILES for 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine is CC(C)(C)c1cc(-c2ccccc2)c(-c2ccnc(Cl)c2)c(-c2ccccc2)c1.
What is the InChIKey of 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine?
The InChIKey is QXDLAHBMHZMGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24ClN/c1-27(2,3)22-17-23(19-10-6-4-7-11-19)26(21-14-15-29-25(28)16-21)24(18-22)20-12-8-5-9-13-20/h4-18H,1-3H3.
What are the key properties of 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine?
4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine has a molecular weight of 397.95 g/mol, XLogP of 8.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-tert-butyl-2,6-diphenylphenyl)-2-chloropyridine is sourced from PubChem (CID 146704594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).