C40H48N2O7 — CID 14670545
3-[[4-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenoxy]-1-hydroxynaphthalene-2-carbonyl]amino]propanoic acid (PubChem CID 14670545) has the molecular formula C40H48N2O7 and a molecular weight of 668.83 g/mol. Its IUPAC name is 3-[[4-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenoxy]-1-hydroxynaphthalene-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-[[4-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenoxy]-1-hydroxynaphthalene-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 14670545 |
| Molecular Formula | C40H48N2O7 |
| Molecular Weight | 668.83 g/mol |
| Exact Mass | 668.35 |
| IUPAC Name | 3-[[4-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenoxy]-1-hydroxynaphthalene-2-carbonyl]amino]propanoic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(Oc3cc(C(=O)NCCC(=O)O)c(O)c4ccccc34)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C40H48N2O7/c1-7-39(3,4)26-15-20-33(32(24-26)40(5,6)8-2)48-23-11-14-35(43)42-27-16-18-28(19-17-27)49-34-25-31(38(47)41-22-21-36(44)45)37(46)30-13-10-9-12-29(30)34/h9-10,12-13,15-20,24-25,46H,7-8,11,14,21-23H2,1-6H3,(H,41,47)(H,42,43)(H,44,45) |
| InChIKey | OHJJIZQFIPEWDQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.83 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_OC_no_alk_B(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|