C21H24N2O4 — CID 14670614
5,5',7-trimethoxy-1',3',3'-trimethylspiro[1,4-benzoxazine-2,2'-indole] (PubChem CID 14670614) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 5,5',7-trimethoxy-1',3',3'-trimethylspiro[1,4-benzoxazine-2,2'-indole].
| Compound Name | 5,5',7-trimethoxy-1',3',3'-trimethylspiro[1,4-benzoxazine-2,2'-indole] |
|---|---|
| PubChem CID | 14670614 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 5,5',7-trimethoxy-1',3',3'-trimethylspiro[1,4-benzoxazine-2,2'-indole] |
| SMILES | COc1cc(OC)c2c(c1)OC1(C=N2)N(C)c2ccc(OC)cc2C1(C)C |
| InChI | InChI=1S/C21H24N2O4/c1-20(2)15-9-13(24-4)7-8-16(15)23(3)21(20)12-22-19-17(26-6)10-14(25-5)11-18(19)27-21/h7-12H,1-6H3 |
| InChIKey | PPEMNBZQONHROL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|