About [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate
[3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate (PubChem CID 146706328) has the molecular formula C23H42O7
and a molecular weight of 430.58 g/mol. Its IUPAC name is [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate.
Molecular Properties
| Compound Name | [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate |
| PubChem CID | 146706328 |
| Molecular Formula | C23H42O7 |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)OCC1OC(OC)CC(OC(=O)C(CCC)CCC)C1O |
| InChI | InChI=1S/C23H42O7/c1-6-10-16(11-7-2)22(25)28-15-19-21(24)18(14-20(27-5)29-19)30-23(26)17(12-8-3)13-9-4/h16-21,24H,6-15H2,1-5H3 |
| InChIKey | QYOMQRWHNDNBCD-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate?
The IUPAC name of [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate (CID 146706328) is [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate.
What is the SMILES notation for [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate?
The canonical SMILES for [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate is CCCC(CCC)C(=O)OCC1OC(OC)CC(OC(=O)C(CCC)CCC)C1O.
What is the InChIKey of [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate?
The InChIKey is QYOMQRWHNDNBCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O7/c1-6-10-16(11-7-2)22(25)28-15-19-21(24)18(14-20(27-5)29-19)30-23(26)17(12-8-3)13-9-4/h16-21,24H,6-15H2,1-5H3.
What are the key properties of [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate?
[3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate has a molecular weight of 430.58 g/mol, XLogP of 4.00, 14 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-hydroxy-6-methoxy-4-(2-propylpentanoyloxy)oxan-2-yl]methyl 2-propylpentanoate is sourced from PubChem (CID 146706328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).