C26H20ClN3O3 — CID 146706873
[4-[4-(4-chlorophenyl)-6-(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] prop-2-enoate (PubChem CID 146706873) has the molecular formula C26H20ClN3O3 and a molecular weight of 457.92 g/mol. Its IUPAC name is [4-[4-(4-chlorophenyl)-6-(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] prop-2-enoate.
| Compound Name | [4-[4-(4-chlorophenyl)-6-(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] prop-2-enoate |
|---|---|
| PubChem CID | 146706873 |
| Molecular Formula | C26H20ClN3O3 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [4-[4-(4-chlorophenyl)-6-(2,4-dimethylphenyl)-1,3,5-triazin-2-yl]-3-hydroxyphenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(-c2nc(-c3ccc(Cl)cc3)nc(-c3ccc(C)cc3C)n2)c(O)c1 |
| InChI | InChI=1S/C26H20ClN3O3/c1-4-23(32)33-19-10-12-21(22(31)14-19)26-29-24(17-6-8-18(27)9-7-17)28-25(30-26)20-11-5-15(2)13-16(20)3/h4-14,31H,1H2,2-3H3 |
| InChIKey | QYRDEANJMNJSJF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|