About 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine
5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine (PubChem CID 14670722) has the molecular formula C11H13NS2
and a molecular weight of 223.37 g/mol. Its IUPAC name is 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine.
Molecular Properties
| Compound Name | 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine |
| PubChem CID | 14670722 |
| Molecular Formula | C11H13NS2 |
| Molecular Weight | 223.37 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine |
| SMILES | CCSC1=NCCSc2ccccc21 |
| InChI | InChI=1S/C11H13NS2/c1-2-13-11-9-5-3-4-6-10(9)14-8-7-12-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | MNXOGYVKDROTMR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine?
The IUPAC name of 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine (CID 14670722) is 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine.
What is the SMILES notation for 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine?
The canonical SMILES for 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine is CCSC1=NCCSc2ccccc21.
What is the InChIKey of 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine?
The InChIKey is MNXOGYVKDROTMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NS2/c1-2-13-11-9-5-3-4-6-10(9)14-8-7-12-11/h3-6H,2,7-8H2,1H3.
What are the key properties of 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine?
5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine has a molecular weight of 223.37 g/mol, XLogP of 3.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylsulfanyl-2,3-dihydro-1,4-benzothiazepine is sourced from PubChem (CID 14670722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).