About methyl 3-methoxydecanoate
methyl 3-methoxydecanoate (PubChem CID 14670805) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is methyl 3-methoxydecanoate.
Molecular Properties
| Compound Name | methyl 3-methoxydecanoate |
| PubChem CID | 14670805 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | methyl 3-methoxydecanoate |
| SMILES | CCCCCCCC(CC(=O)OC)OC |
| InChI | InChI=1S/C12H24O3/c1-4-5-6-7-8-9-11(14-2)10-12(13)15-3/h11H,4-10H2,1-3H3 |
| InChIKey | ZBCDXSCYYHYNFA-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-methoxydecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methoxydecanoate?
The IUPAC name of methyl 3-methoxydecanoate (CID 14670805) is methyl 3-methoxydecanoate.
What is the SMILES notation for methyl 3-methoxydecanoate?
The canonical SMILES for methyl 3-methoxydecanoate is CCCCCCCC(CC(=O)OC)OC.
What is the InChIKey of methyl 3-methoxydecanoate?
The InChIKey is ZBCDXSCYYHYNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3/c1-4-5-6-7-8-9-11(14-2)10-12(13)15-3/h11H,4-10H2,1-3H3.
What are the key properties of methyl 3-methoxydecanoate?
methyl 3-methoxydecanoate has a molecular weight of 216.32 g/mol, XLogP of 2.92, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxydecanoate is sourced from PubChem (CID 14670805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).