About N'-pentan-3-ylethane-1,2-diamine
N'-pentan-3-ylethane-1,2-diamine (PubChem CID 14670812) has the molecular formula C7H18N2
and a molecular weight of 130.23 g/mol. Its IUPAC name is N'-pentan-3-ylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-pentan-3-ylethane-1,2-diamine |
| PubChem CID | 14670812 |
| Molecular Formula | C7H18N2 |
| Molecular Weight | 130.23 g/mol |
| Exact Mass | 130.15 |
| IUPAC Name | N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)NCCN |
| InChI | InChI=1S/C7H18N2/c1-3-7(4-2)9-6-5-8/h7,9H,3-6,8H2,1-2H3 |
| InChIKey | JWRIBBHPRWTITQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-pentan-3-ylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-pentan-3-ylethane-1,2-diamine?
The IUPAC name of N'-pentan-3-ylethane-1,2-diamine (CID 14670812) is N'-pentan-3-ylethane-1,2-diamine.
What is the SMILES notation for N'-pentan-3-ylethane-1,2-diamine?
The canonical SMILES for N'-pentan-3-ylethane-1,2-diamine is CCC(CC)NCCN.
What is the InChIKey of N'-pentan-3-ylethane-1,2-diamine?
The InChIKey is JWRIBBHPRWTITQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18N2/c1-3-7(4-2)9-6-5-8/h7,9H,3-6,8H2,1-2H3.
What are the key properties of N'-pentan-3-ylethane-1,2-diamine?
N'-pentan-3-ylethane-1,2-diamine has a molecular weight of 130.23 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-pentan-3-ylethane-1,2-diamine is sourced from PubChem (CID 14670812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).