About (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine
(3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine (PubChem CID 146709966) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine.
Molecular Properties
| Compound Name | (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine |
| PubChem CID | 146709966 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine |
| SMILES | CC[C@H]1c2ccc3ccccc3c2OC[C@@]1(C)N |
| InChI | InChI=1S/C16H19NO/c1-3-14-13-9-8-11-6-4-5-7-12(11)15(13)18-10-16(14,2)17/h4-9,14H,3,10,17H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | RBHBTBBWGMVKHC-GOEBONIOSA-N |
| XLogP | 3.44 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine?
The IUPAC name of (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine (CID 146709966) is (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine.
What is the SMILES notation for (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine?
The canonical SMILES for (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine is CC[C@H]1c2ccc3ccccc3c2OC[C@@]1(C)N.
What is the InChIKey of (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine?
The InChIKey is RBHBTBBWGMVKHC-GOEBONIOSA-N. The full InChI is InChI=1S/C16H19NO/c1-3-14-13-9-8-11-6-4-5-7-12(11)15(13)18-10-16(14,2)17/h4-9,14H,3,10,17H2,1-2H3/t14-,16+/m0/s1.
What are the key properties of (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine?
(3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine has a molecular weight of 241.33 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4S)-4-ethyl-3-methyl-2,4-dihydrobenzo[h]chromen-3-amine is sourced from PubChem (CID 146709966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).