About 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol
2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol (PubChem CID 14671025) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol |
| PubChem CID | 14671025 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol |
| SMILES | CC1NC=CN1CCO |
| InChI | InChI=1S/C6H12N2O/c1-6-7-2-3-8(6)4-5-9/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | AWTVWIRNMDFUJH-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol?
The IUPAC name of 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol (CID 14671025) is 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol.
What is the SMILES notation for 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol?
The canonical SMILES for 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol is CC1NC=CN1CCO.
What is the InChIKey of 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol?
The InChIKey is AWTVWIRNMDFUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O/c1-6-7-2-3-8(6)4-5-9/h2-3,6-7,9H,4-5H2,1H3.
What are the key properties of 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol?
2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol has a molecular weight of 128.17 g/mol, XLogP of -0.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-1,2-dihydroimidazol-3-yl)ethanol is sourced from PubChem (CID 14671025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).