C25H25N5O4S — CID 146710512
2,5-dimethyl-6-[4-[2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethoxy]-1,3-benzoxazol-2-yl]-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 146710512) has the molecular formula C25H25N5O4S and a molecular weight of 491.57 g/mol. Its IUPAC name is 2,5-dimethyl-6-[4-[2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethoxy]-1,3-benzoxazol-2-yl]-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one.
| Compound Name | 2,5-dimethyl-6-[4-[2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethoxy]-1,3-benzoxazol-2-yl]-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 146710512 |
| Molecular Formula | C25H25N5O4S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | 2,5-dimethyl-6-[4-[2-[(methyl-methylidene-oxo-λ6-sulfanyl)amino]ethoxy]-1,3-benzoxazol-2-yl]-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | C=S(C)(=O)NCCOc1cccc2oc(-c3c(C)nc4c(-c5ccccc5)c(C)[nH]n4c3=O)nc12 |
| InChI | InChI=1S/C25H25N5O4S/c1-15-21(25(31)30-23(27-15)20(16(2)29-30)17-9-6-5-7-10-17)24-28-22-18(11-8-12-19(22)34-24)33-14-13-26-35(3,4)32/h5-12,29H,3,13-14H2,1-2,4H3,(H,26,32) |
| InChIKey | JDRYEDHRODTILA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|