C21H27F2N5OS2 — CID 146714604
(Z)-1-[5-[3-[(2S,3S)-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-sulfanyloxyprop-1-en-2-amine (PubChem CID 146714604) has the molecular formula C21H27F2N5OS2 and a molecular weight of 467.61 g/mol. Its IUPAC name is (Z)-1-[5-[3-[(2S,3S)-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-sulfanyloxyprop-1-en-2-amine.
| Compound Name | (Z)-1-[5-[3-[(2S,3S)-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-sulfanyloxyprop-1-en-2-amine |
|---|---|
| PubChem CID | 146714604 |
| Molecular Formula | C21H27F2N5OS2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | (Z)-1-[5-[3-[(2S,3S)-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptan-5-yl]propylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]-1-sulfanyloxyprop-1-en-2-amine |
| SMILES | C/C(N)=C(/OS)c1nnc(SCCCN2CC[C@]3(C[C@@H]3c3ccc(F)cc3F)C2)n1C |
| InChI | InChI=1S/C21H27F2N5OS2/c1-13(24)18(29-30)19-25-26-20(27(19)2)31-9-3-7-28-8-6-21(12-28)11-16(21)15-5-4-14(22)10-17(15)23/h4-5,10,16,30H,3,6-9,11-12,24H2,1-2H3/b18-13-/t16-,21+/m1/s1 |
| InChIKey | RDEBVRRHTHYCTJ-OHPNUWIJSA-N |
| XLogP | 3.96 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|