C23H34B2N2O4 — CID 146717148
2-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1H-pyrrolo[2,3-b]pyridine (PubChem CID 146717148) has the molecular formula C23H34B2N2O4 and a molecular weight of 424.16 g/mol. Its IUPAC name is 2-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 146717148 |
| Molecular Formula | C23H34B2N2O4 |
| Molecular Weight | 424.16 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2-[(Z)-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC/C(B1OC(C)(C)C(C)(C)O1)=C(/B1OC(C)(C)C(C)(C)O1)c1cc2cccnc2[nH]1 |
| InChI | InChI=1S/C23H34B2N2O4/c1-10-16(24-28-20(2,3)21(4,5)29-24)18(25-30-22(6,7)23(8,9)31-25)17-14-15-12-11-13-26-19(15)27-17/h11-14H,10H2,1-9H3,(H,26,27)/b18-16- |
| InChIKey | RDZWWOTVSAHDPT-VLGSPTGOSA-N |
| XLogP | 4.99 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.16 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|